C21H27FN4O3 — CID 3581909
1-(2,4-dimethoxyphenyl)-3-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]urea (PubChem CID 3581909) has the molecular formula C21H27FN4O3 and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 3581909 |
| Molecular Formula | C21H27FN4O3 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[2-[4-(2-fluorophenyl)piperazin-1-yl]ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCN2CCN(c3ccccc3F)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H27FN4O3/c1-28-16-7-8-18(20(15-16)29-2)24-21(27)23-9-10-25-11-13-26(14-12-25)19-6-4-3-5-17(19)22/h3-8,15H,9-14H2,1-2H3,(H2,23,24,27) |
| InChIKey | VJKLSCVAAPHNSR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |