C18H19N2OS+ — CID 3582295
N-(2,3-dimethylphenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine (PubChem CID 3582295) has the molecular formula C18H19N2OS+ and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine.
| Compound Name | N-(2,3-dimethylphenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 3582295 |
| Molecular Formula | C18H19N2OS+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine |
| SMILES | COc1ccc(-c2csc(Nc3cccc(C)c3C)[nH+]2)cc1 |
| InChI | InChI=1S/C18H18N2OS/c1-12-5-4-6-16(13(12)2)19-18-20-17(11-22-18)14-7-9-15(21-3)10-8-14/h4-11H,1-3H3,(H,19,20)/p+1 |
| InChIKey | UNHATFBMIMMOQC-UHFFFAOYSA-O |
| XLogP | 4.60 |
| TPSA | 35.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'} |
|---|