C23H21FN4O2 — CID 35830253
N-[[4-(dimethylamino)phenyl]methyl]-6-(4-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 35830253) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-6-(4-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-6-(4-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 35830253 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-6-(4-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1noc2nc(-c3ccc(F)cc3)cc(C(=O)NCc3ccc(N(C)C)cc3)c12 |
| InChI | InChI=1S/C23H21FN4O2/c1-14-21-19(22(29)25-13-15-4-10-18(11-5-15)28(2)3)12-20(26-23(21)30-27-14)16-6-8-17(24)9-7-16/h4-12H,13H2,1-3H3,(H,25,29) |
| InChIKey | YZBIQYLXQOCXSM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|