C19H23F3N4O2 — CID 3583341
1-(2-methylphenoxy)-3-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-2-ol (PubChem CID 3583341) has the molecular formula C19H23F3N4O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-(2-methylphenoxy)-3-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-(2-methylphenoxy)-3-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 3583341 |
| Molecular Formula | C19H23F3N4O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-(2-methylphenoxy)-3-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]propan-2-ol |
| SMILES | Cc1ccccc1OCC(O)CN1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C19H23F3N4O2/c1-14-4-2-3-5-16(14)28-13-15(27)12-25-8-10-26(11-9-25)18-23-7-6-17(24-18)19(20,21)22/h2-7,15,27H,8-13H2,1H3 |
| InChIKey | PCEYVGCWKCDQBW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |