C16H19N3O4S — CID 3584264
ethyl 2-(6-acetamido-2-propanoylimino-1,3-benzothiazol-3-yl)acetate (PubChem CID 3584264) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is ethyl 2-(6-acetamido-2-propanoylimino-1,3-benzothiazol-3-yl)acetate.
| Compound Name | ethyl 2-(6-acetamido-2-propanoylimino-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 3584264 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | ethyl 2-(6-acetamido-2-propanoylimino-1,3-benzothiazol-3-yl)acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CC)sc2cc(NC(C)=O)ccc21 |
| InChI | InChI=1S/C16H19N3O4S/c1-4-14(21)18-16-19(9-15(22)23-5-2)12-7-6-11(17-10(3)20)8-13(12)24-16/h6-8H,4-5,9H2,1-3H3,(H,17,20)/b18-16- |
| InChIKey | XTHJIAMBXUCWQJ-VLGSPTGOSA-N |
| XLogP | 2.06 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |