C20H19BrN2O2 — CID 3584852
3-(3-bromophenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 3584852) has the molecular formula C20H19BrN2O2 and a molecular weight of 399.29 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | 3-(3-bromophenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 3584852 |
| Molecular Formula | C20H19BrN2O2 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-(3-bromophenyl)-2-(2-oxo-1-pyridinyl)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)C(=Cc1cccc(Br)c1)n1ccccc1=O |
| InChI | InChI=1S/C20H19BrN2O2/c1-3-11-22(12-4-2)20(25)18(23-13-6-5-10-19(23)24)15-16-8-7-9-17(21)14-16/h3-10,13-15H,1-2,11-12H2 |
| InChIKey | AWOJTEZHGRRNMK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|