C13H11BrN4O4S — CID 35874399
4-bromo-N'-(5-methylsulfanyl-2-nitrobenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 35874399) has the molecular formula C13H11BrN4O4S and a molecular weight of 399.23 g/mol. Its IUPAC name is 4-bromo-N'-(5-methylsulfanyl-2-nitrobenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-(5-methylsulfanyl-2-nitrobenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 35874399 |
| Molecular Formula | C13H11BrN4O4S |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 4-bromo-N'-(5-methylsulfanyl-2-nitrobenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)NNC(=O)c2cc(Br)c[nH]2)c1 |
| InChI | InChI=1S/C13H11BrN4O4S/c1-23-8-2-3-11(18(21)22)9(5-8)12(19)16-17-13(20)10-4-7(14)6-15-10/h2-6,15H,1H3,(H,16,19)(H,17,20) |
| InChIKey | AJMUDMLSPMJXDS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|