C35H37N3O2 — CID 3587460
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-diphenylacetate (PubChem CID 3587460) has the molecular formula C35H37N3O2 and a molecular weight of 531.70 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-diphenylacetate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 3587460 |
| Molecular Formula | C35H37N3O2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-diphenylacetate |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccccc2OC(=O)C(c2ccccc2)c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C35H37N3O2/c1-34(2,3)24-35(4,5)37-32-31(36-29-22-14-15-23-38(29)32)27-20-12-13-21-28(27)40-33(39)30(25-16-8-6-9-17-25)26-18-10-7-11-19-26/h6-23,30,37H,24H2,1-5H3 |
| InChIKey | NBAITCMCYHMTJB-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|