C23H28N2O3 — CID 3589270
2-[2-(cyclohexen-1-yl)ethyl]-5-(3-methylpiperidine-1-carbonyl)isoindole-1,3-dione (PubChem CID 3589270) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl]-5-(3-methylpiperidine-1-carbonyl)isoindole-1,3-dione.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl]-5-(3-methylpiperidine-1-carbonyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 3589270 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl]-5-(3-methylpiperidine-1-carbonyl)isoindole-1,3-dione |
| SMILES | CC1CCCN(C(=O)c2ccc3c(c2)C(=O)N(CCC2=CCCCC2)C3=O)C1 |
| InChI | InChI=1S/C23H28N2O3/c1-16-6-5-12-24(15-16)21(26)18-9-10-19-20(14-18)23(28)25(22(19)27)13-11-17-7-3-2-4-8-17/h7,9-10,14,16H,2-6,8,11-13,15H2,1H3 |
| InChIKey | UFKBKIRJJGPFCE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|