C19H23N5O3S — CID 35903882
[(2R)-1-[2-[(4-methoxyphenyl)methylcarbamothioyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea (PubChem CID 35903882) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is [(2R)-1-[2-[(4-methoxyphenyl)methylcarbamothioyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea.
| Compound Name | [(2R)-1-[2-[(4-methoxyphenyl)methylcarbamothioyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 35903882 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [(2R)-1-[2-[(4-methoxyphenyl)methylcarbamothioyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)[C@@H](Cc2ccccc2)NC(N)=O)cc1 |
| InChI | InChI=1S/C19H23N5O3S/c1-27-15-9-7-14(8-10-15)12-21-19(28)24-23-17(25)16(22-18(20)26)11-13-5-3-2-4-6-13/h2-10,16H,11-12H2,1H3,(H,23,25)(H3,20,22,26)(H2,21,24,28)/t16-/m1/s1 |
| InChIKey | AAZQBOTZVRPAPS-MRXNPFEDSA-N |
| XLogP | 0.97 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|