C25H24N2O4S — CID 3593448
methyl 3-[[3-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoate (PubChem CID 3593448) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is methyl 3-[[3-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[3-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 3593448 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | methyl 3-[[3-[(3-butan-2-yl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]indol-1-yl]methyl]benzoate |
| SMILES | CCC(C)N1C(=O)SC(=Cc2cn(Cc3cccc(C(=O)OC)c3)c3ccccc23)C1=O |
| InChI | InChI=1S/C25H24N2O4S/c1-4-16(2)27-23(28)22(32-25(27)30)13-19-15-26(21-11-6-5-10-20(19)21)14-17-8-7-9-18(12-17)24(29)31-3/h5-13,15-16H,4,14H2,1-3H3 |
| InChIKey | JBIOWDSIIBTIOV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|