C28H44N4O5S — CID 3594470
1-[2-[2-(hexanoylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetyl]piperidine-4-carboxamide (PubChem CID 3594470) has the molecular formula C28H44N4O5S and a molecular weight of 548.75 g/mol. Its IUPAC name is 1-[2-[2-(hexanoylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(hexanoylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3594470 |
| Molecular Formula | C28H44N4O5S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | 1-[2-[2-(hexanoylamino)-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-4-yl]acetyl]piperidine-4-carboxamide |
| SMILES | CCCCCC(=O)Nc1nc2c(s1)CC1C(C)(CO)C(O)CCC1(C)C2CC(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C28H44N4O5S/c1-4-5-6-7-22(35)30-26-31-24-18(14-23(36)32-12-9-17(10-13-32)25(29)37)27(2)11-8-21(34)28(3,16-33)20(27)15-19(24)38-26/h17-18,20-21,33-34H,4-16H2,1-3H3,(H2,29,37)(H,30,31,35) |
| InChIKey | OSKSCBRHVNESMJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|