C30H43N3O5S — CID 3788616
N-[7-hydroxy-8-(hydroxymethyl)-4-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide (PubChem CID 3788616) has the molecular formula C30H43N3O5S and a molecular weight of 557.76 g/mol. Its IUPAC name is N-[7-hydroxy-8-(hydroxymethyl)-4-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide.
| Compound Name | N-[7-hydroxy-8-(hydroxymethyl)-4-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 3788616 |
| Molecular Formula | C30H43N3O5S |
| Molecular Weight | 557.76 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | N-[7-hydroxy-8-(hydroxymethyl)-4-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc2c(s1)CC1C(C)(CO)C(O)CCC1(C)C2CC(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C30H43N3O5S/c1-5-6-7-8-25(36)32-28-33-27-21(15-26(37)31-17-19-9-11-20(38-4)12-10-19)29(2)14-13-24(35)30(3,18-34)23(29)16-22(27)39-28/h9-12,21,23-24,34-35H,5-8,13-18H2,1-4H3,(H,31,37)(H,32,33,36) |
| InChIKey | RGEZBLDZHYHYQD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.76 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|