C32H47N3O6S — CID 3858651
N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide (PubChem CID 3858651) has the molecular formula C32H47N3O6S and a molecular weight of 601.81 g/mol. Its IUPAC name is N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide.
| Compound Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 3858651 |
| Molecular Formula | C32H47N3O6S |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc2c(s1)CC1C(C)(CO)C(O)CCC1(C)C2CC(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C32H47N3O6S/c1-6-7-8-9-27(38)34-30-35-29-21(17-28(39)33-15-13-20-10-11-22(40-4)23(16-20)41-5)31(2)14-12-26(37)32(3,19-36)25(31)18-24(29)42-30/h10-11,16,21,25-26,36-37H,6-9,12-15,17-19H2,1-5H3,(H,33,39)(H,34,35,38) |
| InChIKey | YZQOQMQFUMUCJI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|