C19H22N2O5S — CID 3594853
N,N-diethyl-4-[(4-methylphenyl)methylsulfonyl]-3-nitrobenzamide (PubChem CID 3594853) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is N,N-diethyl-4-[(4-methylphenyl)methylsulfonyl]-3-nitrobenzamide.
| Compound Name | N,N-diethyl-4-[(4-methylphenyl)methylsulfonyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3594853 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N,N-diethyl-4-[(4-methylphenyl)methylsulfonyl]-3-nitrobenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(S(=O)(=O)Cc2ccc(C)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H22N2O5S/c1-4-20(5-2)19(22)16-10-11-18(17(12-16)21(23)24)27(25,26)13-15-8-6-14(3)7-9-15/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | OFYNLNFSZGQUGO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|