C15H10BrN2O2S2- — CID 3595661
3-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropanoate (PubChem CID 3595661) has the molecular formula C15H10BrN2O2S2- and a molecular weight of 394.30 g/mol. Its IUPAC name is 3-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropanoate.
| Compound Name | 3-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 3595661 |
| Molecular Formula | C15H10BrN2O2S2- |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | 3-[5-(4-bromophenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylpropanoate |
| SMILES | O=C([O-])CCSc1ncnc2scc(-c3ccc(Br)cc3)c12 |
| InChI | InChI=1S/C15H11BrN2O2S2/c16-10-3-1-9(2-4-10)11-7-22-15-13(11)14(17-8-18-15)21-6-5-12(19)20/h1-4,7-8H,5-6H2,(H,19,20)/p-1 |
| InChIKey | VVVDCPBEDOBOQV-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |