C17H15N2O2S2- — CID 3471375
2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylbutanoate (PubChem CID 3471375) has the molecular formula C17H15N2O2S2- and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylbutanoate.
| Compound Name | 2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylbutanoate |
|---|---|
| PubChem CID | 3471375 |
| Molecular Formula | C17H15N2O2S2- |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-[5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylbutanoate |
| SMILES | CCC(Sc1ncnc2scc(-c3ccc(C)cc3)c12)C(=O)[O-] |
| InChI | InChI=1S/C17H16N2O2S2/c1-3-13(17(20)21)23-16-14-12(8-22-15(14)18-9-19-16)11-6-4-10(2)5-7-11/h4-9,13H,3H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | CCRGYDQNVWXDNZ-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |