C20H18ClFN2OS — CID 3596266
3-(2-chloro-6-fluorophenyl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide (PubChem CID 3596266) has the molecular formula C20H18ClFN2OS and a molecular weight of 388.90 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3596266 |
| Molecular Formula | C20H18ClFN2OS |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-(3-cyano-6-ethyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)prop-2-enamide |
| SMILES | CCC1CCc2c(sc(NC(=O)C=Cc3c(F)cccc3Cl)c2C#N)C1 |
| InChI | InChI=1S/C20H18ClFN2OS/c1-2-12-6-7-13-15(11-23)20(26-18(13)10-12)24-19(25)9-8-14-16(21)4-3-5-17(14)22/h3-5,8-9,12H,2,6-7,10H2,1H3,(H,24,25) |
| InChIKey | PZTIKTPOWLSFEZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|