C21H22ClFN2O2S — CID 4069766
2-[3-(2-chloro-6-fluorophenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4069766) has the molecular formula C21H22ClFN2O2S and a molecular weight of 420.94 g/mol. Its IUPAC name is 2-[3-(2-chloro-6-fluorophenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-(2-chloro-6-fluorophenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4069766 |
| Molecular Formula | C21H22ClFN2O2S |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[3-(2-chloro-6-fluorophenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCC1CCc2c(sc(NC(=O)C=Cc3c(F)cccc3Cl)c2C(N)=O)C1 |
| InChI | InChI=1S/C21H22ClFN2O2S/c1-2-4-12-7-8-14-17(11-12)28-21(19(14)20(24)27)25-18(26)10-9-13-15(22)5-3-6-16(13)23/h3,5-6,9-10,12H,2,4,7-8,11H2,1H3,(H2,24,27)(H,25,26) |
| InChIKey | AABSDCNXDOBVED-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|