C25H32N2O2S — CID 5161605
2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5161605) has the molecular formula C25H32N2O2S and a molecular weight of 424.61 g/mol. Its IUPAC name is 2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5161605 |
| Molecular Formula | C25H32N2O2S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[3-(4-tert-butylphenyl)prop-2-enoylamino]-6-propyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCC1CCc2c(sc(NC(=O)C=Cc3ccc(C(C)(C)C)cc3)c2C(N)=O)C1 |
| InChI | InChI=1S/C25H32N2O2S/c1-5-6-17-9-13-19-20(15-17)30-24(22(19)23(26)29)27-21(28)14-10-16-7-11-18(12-8-16)25(2,3)4/h7-8,10-12,14,17H,5-6,9,13,15H2,1-4H3,(H2,26,29)(H,27,28) |
| InChIKey | BANPZUOBDASXEV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|