C20H20N2O2S — CID 3596529
N-(6-methyl-7-oxo-5-phenyl-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-phenylacetamide (PubChem CID 3596529) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-(6-methyl-7-oxo-5-phenyl-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-phenylacetamide.
| Compound Name | N-(6-methyl-7-oxo-5-phenyl-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 3596529 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(6-methyl-7-oxo-5-phenyl-4-thia-1-azabicyclo[3.2.0]heptan-6-yl)-2-phenylacetamide |
| SMILES | CC1(NC(=O)Cc2ccccc2)C(=O)N2CCSC21c1ccccc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-19(21-17(23)14-15-8-4-2-5-9-15)18(24)22-12-13-25-20(19,22)16-10-6-3-7-11-16/h2-11H,12-14H2,1H3,(H,21,23) |
| InChIKey | XREQXVPCTQXAKR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |