C23H25N3O5S2 — CID 3600197
N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-3-methylthiophene-2-carboxamide (PubChem CID 3600197) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 3600197 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-3-methylthiophene-2-carboxamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)c3sccc3C)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-16-9-14-32-22(16)23(27)24-18-5-8-20(26-10-12-31-13-11-26)21(15-18)33(28,29)25-17-3-6-19(30-2)7-4-17/h3-9,14-15,25H,10-13H2,1-2H3,(H,24,27) |
| InChIKey | WGZZCOFPINTINO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|