C24H27N3O5S2 — CID 5177115
3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 5177115) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 5177115 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 3-[(4-methoxyphenyl)sulfamoyl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C(=O)NCC(c3cccs3)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C24H27N3O5S2/c1-31-20-9-7-19(8-10-20)26-34(29,30)21-5-2-4-18(16-21)24(28)25-17-22(23-6-3-15-33-23)27-11-13-32-14-12-27/h2-10,15-16,22,26H,11-14,17H2,1H3,(H,25,28) |
| InChIKey | GNFCYHNKTCDOSM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |