C23H26ClN5O7S — CID 3601726
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate (PubChem CID 3601726) has the molecular formula C23H26ClN5O7S and a molecular weight of 552.01 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate |
|---|---|
| PubChem CID | 3601726 |
| Molecular Formula | C23H26ClN5O7S |
| Molecular Weight | 552.01 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 3-[5-(diethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(CCC(=O)OCC(=O)Nc1ccc(Cl)c([N+](=O)[O-])c1)n2C |
| InChI | InChI=1S/C23H26ClN5O7S/c1-4-28(5-2)37(34,35)16-7-9-19-18(13-16)26-21(27(19)3)10-11-23(31)36-14-22(30)25-15-6-8-17(24)20(12-15)29(32)33/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H,25,30) |
| InChIKey | UHAHQKUCBATNIA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.01 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|