C24H14FN3O7 — CID 3603163
[2-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-nitrobenzoate (PubChem CID 3603163) has the molecular formula C24H14FN3O7 and a molecular weight of 475.39 g/mol. Its IUPAC name is [2-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 3603163 |
| Molecular Formula | C24H14FN3O7 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | [2-[[1-(2-fluorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenyl] 4-nitrobenzoate |
| SMILES | O=C1NC(=O)N(c2ccccc2F)C(=O)C1=Cc1ccccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H14FN3O7/c25-18-6-2-3-7-19(18)27-22(30)17(21(29)26-24(27)32)13-15-5-1-4-8-20(15)35-23(31)14-9-11-16(12-10-14)28(33)34/h1-13H,(H,26,29,32) |
| InChIKey | RLQMYUUZFGUADH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|