C28H23N3O5 — CID 3603226
4-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide (PubChem CID 3603226) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3603226 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yloxymethyl)-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1)c1ccc(COc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C28H23N3O5/c32-28(30-29-17-26-14-15-27(36-26)21-8-11-24(12-9-21)31(33)34)22-6-4-19(5-7-22)18-35-25-13-10-20-2-1-3-23(20)16-25/h4-17H,1-3,18H2,(H,30,32) |
| InChIKey | DSHLYFBKMLWYRZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|