C28H23N5O5S — CID 3604457
(7'-amino-6'-cyano-9,11,11-trimethyl-2,4'-dioxo-2'-sulfanylidenespiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,5'-1H-pyrano[2,3-d]pyrimidine]-6-yl) benzoate (PubChem CID 3604457) has the molecular formula C28H23N5O5S and a molecular weight of 541.59 g/mol. Its IUPAC name is (7'-amino-6'-cyano-9,11,11-trimethyl-2,4'-dioxo-2'-sulfanylidenespiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,5'-1H-pyrano[2,3-d]pyrimidine]-6-yl) benzoate.
| Compound Name | (7'-amino-6'-cyano-9,11,11-trimethyl-2,4'-dioxo-2'-sulfanylidenespiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,5'-1H-pyrano[2,3-d]pyrimidine]-6-yl) benzoate |
|---|---|
| PubChem CID | 3604457 |
| Molecular Formula | C28H23N5O5S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | (7'-amino-6'-cyano-9,11,11-trimethyl-2,4'-dioxo-2'-sulfanylidenespiro[1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene-3,5'-1H-pyrano[2,3-d]pyrimidine]-6-yl) benzoate |
| SMILES | CC1CC(C)(C)N2C(=O)C3(C(C#N)=C(N)Oc4[nH]c(=S)[nH]c(=O)c43)c3cc(OC(=O)c4ccccc4)cc1c32 |
| InChI | InChI=1S/C28H23N5O5S/c1-13-11-27(2,3)33-20-16(13)9-15(37-24(35)14-7-5-4-6-8-14)10-17(20)28(25(33)36)18(12-29)21(30)38-23-19(28)22(34)31-26(39)32-23/h4-10,13H,11,30H2,1-3H3,(H2,31,32,34,39) |
| InChIKey | BJFZSTLPXJDSHJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|