C12H9N5O2 — CID 3606271
N-[4-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide (PubChem CID 3606271) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-[4-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3606271 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[4-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nn[nH]n2)cc1)c1ccco1 |
| InChI | InChI=1S/C12H9N5O2/c18-12(10-2-1-7-19-10)13-9-5-3-8(4-6-9)11-14-16-17-15-11/h1-7H,(H,13,18)(H,14,15,16,17) |
| InChIKey | RYOAWDFSWSEDRC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |