C20H15FN6O3 — CID 167909853
N-[5-[[2-fluoro-5-(2H-tetrazol-5-yl)phenyl]carbamoyl]-2-methylphenyl]furan-2-carboxamide (PubChem CID 167909853) has the molecular formula C20H15FN6O3 and a molecular weight of 406.38 g/mol. Its IUPAC name is N-[5-[[2-fluoro-5-(2H-tetrazol-5-yl)phenyl]carbamoyl]-2-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[5-[[2-fluoro-5-(2H-tetrazol-5-yl)phenyl]carbamoyl]-2-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 167909853 |
| Molecular Formula | C20H15FN6O3 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[5-[[2-fluoro-5-(2H-tetrazol-5-yl)phenyl]carbamoyl]-2-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(-c3nn[nH]n3)ccc2F)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C20H15FN6O3/c1-11-4-5-13(10-15(11)22-20(29)17-3-2-8-30-17)19(28)23-16-9-12(6-7-14(16)21)18-24-26-27-25-18/h2-10H,1H3,(H,22,29)(H,23,28)(H,24,25,26,27) |
| InChIKey | DQVYMZYQQRTNQM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |