C29H27ClN2O3S — CID 3608681
N,N-dibenzyl-4-chloro-3-[(2,3-dimethylphenyl)sulfamoyl]benzamide (PubChem CID 3608681) has the molecular formula C29H27ClN2O3S and a molecular weight of 519.07 g/mol. Its IUPAC name is N,N-dibenzyl-4-chloro-3-[(2,3-dimethylphenyl)sulfamoyl]benzamide.
| Compound Name | N,N-dibenzyl-4-chloro-3-[(2,3-dimethylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 3608681 |
| Molecular Formula | C29H27ClN2O3S |
| Molecular Weight | 519.07 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | N,N-dibenzyl-4-chloro-3-[(2,3-dimethylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)N(Cc3ccccc3)Cc3ccccc3)ccc2Cl)c1C |
| InChI | InChI=1S/C29H27ClN2O3S/c1-21-10-9-15-27(22(21)2)31-36(34,35)28-18-25(16-17-26(28)30)29(33)32(19-23-11-5-3-6-12-23)20-24-13-7-4-8-14-24/h3-18,31H,19-20H2,1-2H3 |
| InChIKey | TVZYIGFDAFCGSP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.07 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |