C28H25ClN2O3S — CID 5126188
N,N-dibenzyl-4-chloro-3-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 5126188) has the molecular formula C28H25ClN2O3S and a molecular weight of 505.04 g/mol. Its IUPAC name is N,N-dibenzyl-4-chloro-3-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N,N-dibenzyl-4-chloro-3-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 5126188 |
| Molecular Formula | C28H25ClN2O3S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N,N-dibenzyl-4-chloro-3-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1cc(C(=O)N(Cc2ccccc2)Cc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C28H25ClN2O3S/c1-21-10-8-9-15-26(21)30-35(33,34)27-18-24(16-17-25(27)29)28(32)31(19-22-11-4-2-5-12-22)20-23-13-6-3-7-14-23/h2-18,30H,19-20H2,1H3 |
| InChIKey | VLSVIZPXPDCDIV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |