C23H17N3O6 — CID 3609277
N,1-bis(1,3-benzodioxol-5-yl)-4-oxo-2-pyridin-3-ylazetidine-2-carboxamide (PubChem CID 3609277) has the molecular formula C23H17N3O6 and a molecular weight of 431.40 g/mol. Its IUPAC name is N,1-bis(1,3-benzodioxol-5-yl)-4-oxo-2-pyridin-3-ylazetidine-2-carboxamide.
| Compound Name | N,1-bis(1,3-benzodioxol-5-yl)-4-oxo-2-pyridin-3-ylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 3609277 |
| Molecular Formula | C23H17N3O6 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N,1-bis(1,3-benzodioxol-5-yl)-4-oxo-2-pyridin-3-ylazetidine-2-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccc3c(c2)OCO3)(c2cccnc2)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H17N3O6/c27-21-10-23(14-2-1-7-24-11-14,26(21)16-4-6-18-20(9-16)32-13-30-18)22(28)25-15-3-5-17-19(8-15)31-12-29-17/h1-9,11H,10,12-13H2,(H,25,28) |
| InChIKey | CLVNKZGCIQONCL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |