C29H31N3O — CID 3613244
3-(1H-indol-3-yl)-3-(3-methylphenyl)-1-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one (PubChem CID 3613244) has the molecular formula C29H31N3O and a molecular weight of 437.59 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-3-(3-methylphenyl)-1-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-(1H-indol-3-yl)-3-(3-methylphenyl)-1-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 3613244 |
| Molecular Formula | C29H31N3O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 3-(1H-indol-3-yl)-3-(3-methylphenyl)-1-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1cccc(C(CC(=O)N2CCN(c3ccccc3C)CC2)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C29H31N3O/c1-21-8-7-10-23(18-21)25(26-20-30-27-12-5-4-11-24(26)27)19-29(33)32-16-14-31(15-17-32)28-13-6-3-9-22(28)2/h3-13,18,20,25,30H,14-17,19H2,1-2H3 |
| InChIKey | XZUKCRUYZKDQSI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |