C28H25F3N4O3 — CID 93122166
(3S)-3-(1H-indol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 93122166) has the molecular formula C28H25F3N4O3 and a molecular weight of 522.53 g/mol. Its IUPAC name is (3S)-3-(1H-indol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | (3S)-3-(1H-indol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 93122166 |
| Molecular Formula | C28H25F3N4O3 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (3S)-3-(1H-indol-3-yl)-1-[4-(4-nitrophenyl)piperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | O=C(C[C@@H](c1cccc(C(F)(F)F)c1)c1c[nH]c2ccccc12)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C28H25F3N4O3/c29-28(30,31)20-5-3-4-19(16-20)24(25-18-32-26-7-2-1-6-23(25)26)17-27(36)34-14-12-33(13-15-34)21-8-10-22(11-9-21)35(37)38/h1-11,16,18,24,32H,12-15,17H2/t24-/m0/s1 |
| InChIKey | UGTODKBDYPSKCB-DEOSSOPVSA-N |
| XLogP | 5.97 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|