C13H23N — CID 3613451
(3,5-dimethyl-1-adamantyl)methanamine (PubChem CID 3613451) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)methanamine.
| Compound Name | (3,5-dimethyl-1-adamantyl)methanamine |
|---|---|
| PubChem CID | 3613451 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)methanamine |
| SMILES | CC12CC3CC(C)(C1)CC(CN)(C3)C2 |
| InChI | InChI=1S/C13H23N/c1-11-3-10-4-12(2,6-11)8-13(5-10,7-11)9-14/h10H,3-9,14H2,1-2H3 |
| InChIKey | GPYYBGAAAREIRT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |