C9H13N3S2 — CID 3615411
4-(2-methylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 3615411) has the molecular formula C9H13N3S2 and a molecular weight of 227.36 g/mol. Its IUPAC name is 4-(2-methylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-(2-methylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 3615411 |
| Molecular Formula | C9H13N3S2 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 4-(2-methylsulfanylethyl)-3,5,6,7-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | CSCCc1[nH]c(=S)nc2c1CCN2 |
| InChI | InChI=1S/C9H13N3S2/c1-14-5-3-7-6-2-4-10-8(6)12-9(13)11-7/h2-5H2,1H3,(H2,10,11,12,13) |
| InChIKey | WWUXFCIWEIPPBQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|