C32H23ClN2O6 — CID 3617479
[2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 6-chloro-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylate (PubChem CID 3617479) has the molecular formula C32H23ClN2O6 and a molecular weight of 567.00 g/mol. Its IUPAC name is [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 6-chloro-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylate.
| Compound Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 6-chloro-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3617479 |
| Molecular Formula | C32H23ClN2O6 |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 6-chloro-3-methyl-2-(4-methylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2nc3ccc(Cl)cc3c(C(=O)OCC(=O)c3ccc(Oc4ccc([N+](=O)[O-])cc4)cc3)c2C)cc1 |
| InChI | InChI=1S/C32H23ClN2O6/c1-19-3-5-22(6-4-19)31-20(2)30(27-17-23(33)9-16-28(27)34-31)32(37)40-18-29(36)21-7-12-25(13-8-21)41-26-14-10-24(11-15-26)35(38)39/h3-17H,18H2,1-2H3 |
| InChIKey | BJXSXIOQUSNGFX-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|