C27H27N3O2S2 — CID 3617764
N-(3,5-dimethylphenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 3617764) has the molecular formula C27H27N3O2S2 and a molecular weight of 489.67 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3617764 |
| Molecular Formula | C27H27N3O2S2 |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CSc2nc3sc4c(c3c(=O)n2-c2ccccc2)CCC(C)C4)c1 |
| InChI | InChI=1S/C27H27N3O2S2/c1-16-9-10-21-22(14-16)34-25-24(21)26(32)30(20-7-5-4-6-8-20)27(29-25)33-15-23(31)28-19-12-17(2)11-18(3)13-19/h4-8,11-13,16H,9-10,14-15H2,1-3H3,(H,28,31) |
| InChIKey | TXSXFSSCXGDZED-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |