C25H21Cl2N3O2S2 — CID 44640291
N-(2,4-dichlorophenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 44640291) has the molecular formula C25H21Cl2N3O2S2 and a molecular weight of 530.50 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 44640291 |
| Molecular Formula | C25H21Cl2N3O2S2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[(7-methyl-4-oxo-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CC1CCc2c(sc3nc(SCC(=O)Nc4ccc(Cl)cc4Cl)n(-c4ccccc4)c(=O)c23)C1 |
| InChI | InChI=1S/C25H21Cl2N3O2S2/c1-14-7-9-17-20(11-14)34-23-22(17)24(32)30(16-5-3-2-4-6-16)25(29-23)33-13-21(31)28-19-10-8-15(26)12-18(19)27/h2-6,8,10,12,14H,7,9,11,13H2,1H3,(H,28,31) |
| InChIKey | ZADQEZRAUZIMTI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |