C11H17N2O3S+ — CID 3619747
[amino-[(5-ethoxycarbonyl-2-ethylfuran-3-yl)methylsulfanyl]methylidene]azanium (PubChem CID 3619747) has the molecular formula C11H17N2O3S+ and a molecular weight of 257.33 g/mol. Its IUPAC name is [amino-[(5-ethoxycarbonyl-2-ethylfuran-3-yl)methylsulfanyl]methylidene]azanium.
| Compound Name | [amino-[(5-ethoxycarbonyl-2-ethylfuran-3-yl)methylsulfanyl]methylidene]azanium |
|---|---|
| PubChem CID | 3619747 |
| Molecular Formula | C11H17N2O3S+ |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | [amino-[(5-ethoxycarbonyl-2-ethylfuran-3-yl)methylsulfanyl]methylidene]azanium |
| SMILES | CCOC(=O)c1cc(CSC(N)=[NH2+])c(CC)o1 |
| InChI | InChI=1S/C11H16N2O3S/c1-3-8-7(6-17-11(12)13)5-9(16-8)10(14)15-4-2/h5H,3-4,6H2,1-2H3,(H3,12,13)/p+1 |
| InChIKey | YHJKBYASFNHHEM-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|