C25H27ClN6O6 — CID 3621594
N-[1-[4-[2-(4-chloro-2-methylphenoxy)propanoylamino]phenyl]ethylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide (PubChem CID 3621594) has the molecular formula C25H27ClN6O6 and a molecular weight of 542.98 g/mol. Its IUPAC name is N-[1-[4-[2-(4-chloro-2-methylphenoxy)propanoylamino]phenyl]ethylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[4-[2-(4-chloro-2-methylphenoxy)propanoylamino]phenyl]ethylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 3621594 |
| Molecular Formula | C25H27ClN6O6 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | N-[1-[4-[2-(4-chloro-2-methylphenoxy)propanoylamino]phenyl]ethylideneamino]-2-(3-methoxy-4-nitropyrazol-1-yl)propanamide |
| SMILES | COc1nn(C(C)C(=O)NN=C(C)c2ccc(NC(=O)C(C)Oc3ccc(Cl)cc3C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H27ClN6O6/c1-14-12-19(26)8-11-22(14)38-17(4)24(34)27-20-9-6-18(7-10-20)15(2)28-29-23(33)16(3)31-13-21(32(35)36)25(30-31)37-5/h6-13,16-17H,1-5H3,(H,27,34)(H,29,33) |
| InChIKey | DTNIPQLEPSAJEX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|