C26H27N2O+ — CID 3622129
dibenzyl-[(2,8-dimethyl-4-oxo-1H-quinolin-3-yl)methyl]azanium (PubChem CID 3622129) has the molecular formula C26H27N2O+ and a molecular weight of 383.52 g/mol. Its IUPAC name is dibenzyl-[(2,8-dimethyl-4-oxo-1H-quinolin-3-yl)methyl]azanium.
| Compound Name | dibenzyl-[(2,8-dimethyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 3622129 |
| Molecular Formula | C26H27N2O+ |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | dibenzyl-[(2,8-dimethyl-4-oxo-1H-quinolin-3-yl)methyl]azanium |
| SMILES | Cc1[nH]c2c(C)cccc2c(=O)c1C[NH+](Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H26N2O/c1-19-10-9-15-23-25(19)27-20(2)24(26(23)29)18-28(16-21-11-5-3-6-12-21)17-22-13-7-4-8-14-22/h3-15H,16-18H2,1-2H3,(H,27,29)/p+1 |
| InChIKey | DMHFPFJJBUKCGQ-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |