C38H54O2 — CID 3623212
10-[(4-methoxyphenyl)methylidene]-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one (PubChem CID 3623212) has the molecular formula C38H54O2 and a molecular weight of 542.85 g/mol. Its IUPAC name is 10-[(4-methoxyphenyl)methylidene]-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one.
| Compound Name | 10-[(4-methoxyphenyl)methylidene]-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one |
|---|---|
| PubChem CID | 3623212 |
| Molecular Formula | C38H54O2 |
| Molecular Weight | 542.85 g/mol |
| Exact Mass | 542.41 |
| IUPAC Name | 10-[(4-methoxyphenyl)methylidene]-3a,5a,5b,8,8,11a-hexamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-one |
| SMILES | C=C(C)C1CCC2(C)CCC3(C)C(CCC4C5(C)CC(=Cc6ccc(OC)cc6)C(=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C38H54O2/c1-24(2)28-16-18-35(5)20-21-37(7)29(32(28)35)14-15-31-36(6)23-26(22-25-10-12-27(40-9)13-11-25)33(39)34(3,4)30(36)17-19-38(31,37)8/h10-13,22,28-32H,1,14-21,23H2,2-9H3 |
| InChIKey | QHAWWXDLICZWMB-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.85 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|