C31H28N4O2S2 — CID 3623837
3-benzhydrylsulfanyl-4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazole (PubChem CID 3623837) has the molecular formula C31H28N4O2S2 and a molecular weight of 552.73 g/mol. Its IUPAC name is 3-benzhydrylsulfanyl-4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazole.
| Compound Name | 3-benzhydrylsulfanyl-4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 3623837 |
| Molecular Formula | C31H28N4O2S2 |
| Molecular Weight | 552.73 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 3-benzhydrylsulfanyl-4-phenyl-5-(3-pyrrolidin-1-ylsulfonylphenyl)-1,2,4-triazole |
| SMILES | O=S(=O)(c1cccc(-c2nnc(SC(c3ccccc3)c3ccccc3)n2-c2ccccc2)c1)N1CCCC1 |
| InChI | InChI=1S/C31H28N4O2S2/c36-39(37,34-21-10-11-22-34)28-20-12-17-26(23-28)30-32-33-31(35(30)27-18-8-3-9-19-27)38-29(24-13-4-1-5-14-24)25-15-6-2-7-16-25/h1-9,12-20,23,29H,10-11,21-22H2 |
| InChIKey | VDPWGQQBZXBRCZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |