C19H20INO3 — CID 3627478
ethyl 4-(3-iodophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 3627478) has the molecular formula C19H20INO3 and a molecular weight of 437.28 g/mol. Its IUPAC name is ethyl 4-(3-iodophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | ethyl 4-(3-iodophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 3627478 |
| Molecular Formula | C19H20INO3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | ethyl 4-(3-iodophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CCC2)C(c2cccc(I)c2)C1C(=O)OCC |
| InChI | InChI=1S/C19H20INO3/c1-3-24-19(23)16-11(2)21-14-8-5-9-15(22)18(14)17(16)12-6-4-7-13(20)10-12/h4,6-7,10,16-17,21H,2-3,5,8-9H2,1H3 |
| InChIKey | HSJGWTFMDVZMPN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|