C18H21N2O3+ — CID 4753265
methyl 2-methylidene-4-(6-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 4753265) has the molecular formula C18H21N2O3+ and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 2-methylidene-4-(6-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | methyl 2-methylidene-4-(6-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4753265 |
| Molecular Formula | C18H21N2O3+ |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | methyl 2-methylidene-4-(6-methylpyridin-1-ium-2-yl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CCC2)C(c2cccc(C)[nH+]2)C1C(=O)OC |
| InChI | InChI=1S/C18H20N2O3/c1-10-6-4-7-13(19-10)17-15(18(22)23-3)11(2)20-12-8-5-9-14(21)16(12)17/h4,6-7,15,17,20H,2,5,8-9H2,1,3H3/p+1 |
| InChIKey | OXLAJLBGEIZWAK-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |