C25H23FN2O6 — CID 4748522
methyl 4-[4-[(3-fluorophenyl)methoxy]-3-nitrophenyl]-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 4748522) has the molecular formula C25H23FN2O6 and a molecular weight of 466.47 g/mol. Its IUPAC name is methyl 4-[4-[(3-fluorophenyl)methoxy]-3-nitrophenyl]-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | methyl 4-[4-[(3-fluorophenyl)methoxy]-3-nitrophenyl]-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4748522 |
| Molecular Formula | C25H23FN2O6 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | methyl 4-[4-[(3-fluorophenyl)methoxy]-3-nitrophenyl]-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CCC2)C(c2ccc(OCc3cccc(F)c3)c([N+](=O)[O-])c2)C1C(=O)OC |
| InChI | InChI=1S/C25H23FN2O6/c1-14-22(25(30)33-2)23(24-18(27-14)7-4-8-20(24)29)16-9-10-21(19(12-16)28(31)32)34-13-15-5-3-6-17(26)11-15/h3,5-6,9-12,22-23,27H,1,4,7-8,13H2,2H3 |
| InChIKey | QRVMMCOZTGAZEM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|