C28H29ClN2O6 — CID 4748526
ethyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-7,7-dimethyl-2-methylidene-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 4748526) has the molecular formula C28H29ClN2O6 and a molecular weight of 525.00 g/mol. Its IUPAC name is ethyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-7,7-dimethyl-2-methylidene-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-7,7-dimethyl-2-methylidene-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 4748526 |
| Molecular Formula | C28H29ClN2O6 |
| Molecular Weight | 525.00 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | ethyl 4-[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]-7,7-dimethyl-2-methylidene-5-oxo-3,4,6,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CC(C)(C)C2)C(c2ccc(OCc3ccc(Cl)cc3)c([N+](=O)[O-])c2)C1C(=O)OCC |
| InChI | InChI=1S/C28H29ClN2O6/c1-5-36-27(33)24-16(2)30-20-13-28(3,4)14-22(32)26(20)25(24)18-8-11-23(21(12-18)31(34)35)37-15-17-6-9-19(29)10-7-17/h6-12,24-25,30H,2,5,13-15H2,1,3-4H3 |
| InChIKey | AEJVIQQMGNSHKC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.00 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|