C27H28ClNO5 — CID 4062344
ethyl 7-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 4062344) has the molecular formula C27H28ClNO5 and a molecular weight of 481.98 g/mol. Its IUPAC name is ethyl 7-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | ethyl 7-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4062344 |
| Molecular Formula | C27H28ClNO5 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | ethyl 7-(4-chlorophenyl)-4-(3,4-dimethoxyphenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CC(c3ccc(Cl)cc3)C2)C(c2ccc(OC)c(OC)c2)C1C(=O)OCC |
| InChI | InChI=1S/C27H28ClNO5/c1-5-34-27(31)24-15(2)29-20-12-18(16-6-9-19(28)10-7-16)13-21(30)26(20)25(24)17-8-11-22(32-3)23(14-17)33-4/h6-11,14,18,24-25,29H,2,5,12-13H2,1,3-4H3 |
| InChIKey | WKBIXADNELGCRI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |