C32H37NO5 — CID 4747857
cyclohexyl 7-(3,4-dimethoxyphenyl)-2-methylidene-4-(3-methylphenyl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate (PubChem CID 4747857) has the molecular formula C32H37NO5 and a molecular weight of 515.65 g/mol. Its IUPAC name is cyclohexyl 7-(3,4-dimethoxyphenyl)-2-methylidene-4-(3-methylphenyl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate.
| Compound Name | cyclohexyl 7-(3,4-dimethoxyphenyl)-2-methylidene-4-(3-methylphenyl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 4747857 |
| Molecular Formula | C32H37NO5 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.27 |
| IUPAC Name | cyclohexyl 7-(3,4-dimethoxyphenyl)-2-methylidene-4-(3-methylphenyl)-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carboxylate |
| SMILES | C=C1NC2=C(C(=O)CC(c3ccc(OC)c(OC)c3)C2)C(c2cccc(C)c2)C1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C32H37NO5/c1-19-9-8-10-22(15-19)30-29(32(35)38-24-11-6-5-7-12-24)20(2)33-25-16-23(17-26(34)31(25)30)21-13-14-27(36-3)28(18-21)37-4/h8-10,13-15,18,23-24,29-30,33H,2,5-7,11-12,16-17H2,1,3-4H3 |
| InChIKey | HMPVGQFQIHKTPQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |